(2S)-2-phenylpropanoic acid is a chiral carboxylic acid used primarily in co-crystallization studies. Its significance lies in its ability to form co-crystals with isonicotinamide, influencing melting-point behavior as investigated in crystallographic research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 7782-24-3
Iodic acid
Astringent and disinfectant
SELENIOUS ACID
Reagent for alkaloids and oxidizing agent
Molybdenum hexafluoride
Isotope separation reagent
(S)-1-(4-Bromophenyl)-2,2,2-trifluoroethanamine
Research compound
(2R)-2-phenylpropanoic acid
chiral building block for pharmaceuticals
2-Phenylpropionic acid
Human xenobiotic metabolite research
(2S)-2-phenylpropanoic acid
YPGCWEMNNLXISK-ZETCQYMHSA-N
C[C@@H](C1=CC=CC=C1)C(=O)O