4-Fluoro-3-phenoxybenzoic acid is an agrochemical metabolite characterized by a carboxylic acid group, ether linkage, and an aromatic fluorine substituent. Its structure includes two aromatic rings and a halogen, contributing to its moderate lipophilicity and potential as a research reference standard.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 77279-89-1
Thiacloprid TP2
Agrochemical metabolite
(2E)-2-methoxyimino-2-[2-[[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]oxymethyl]phenyl]acetic acid
Agrochemical metabolite
2-tert-butylimino-1-oxo-5-phenyl-3-propan-2-yl-1,3,5-thiadiazinan-4-one
Agrochemical metabolite
2-(2-methoxy-ethoxymethyl)-6-trifluoromethyl-nicotinic acid
Agrochemical metabolite
نترات البوتاسيوم
Pesticide active ingredient
كبريتات النحاس الثنائي
Fungicide and pesticide ingredient
Copper sulfate pentahydrate
Fungicide and pesticide active ingredient
AMMONIUM SULFAMATE
broad spectrum herbicide
4-fluoro-3-phenoxybenzoic acid
VLXNXMTVRWIUJZ-UHFFFAOYSA-N
C1=CC=C(C=C1)OC2=C(C=CC(=C2)C(=O)O)F