2-HYDROXY-5-NITROBENZYL BROMIDE is a chemical compound commonly used as a laboratory reagent. Its primary significance is in research applications for the chemical modification of tryptophan residues in proteins.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 772-33-8
(1,1-2H2)-2,2,2-Trifluoroetane-1-(2H)ol
Deuterated NMR reference standard
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Fmoc-protected amino acid for peptide synthesis
3-Amino-3-(1-methyl-1H-pyrrol-2-yl)propanoic acid
research compound for peptide synthesis
1,3-Benzodioxole-5-carboxylic acid, 2,2-difluoro-, methyl ester
research compound
2-(bromomethyl)-4-nitrophenol
KFDPCYZHENQOBV-UHFFFAOYSA-N
C1=CC(=C(C=C1[N+](=O)[O-])CBr)O