This compound is a highly functionalized, tricyclic organic molecule containing multiple alcohol, amine, and ether groups. Its structure includes two guanidine moieties and a deuterium label, suggesting it is a research compound or synthetic intermediate used in pharmaceutical development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 77093-29-9
1-[(1R,2R,3S,4R,5R,6S)-3-(diaminomethylideneamino)-4-[(2S,3R,4R,5S)-3-[(2S,3S,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-3-(methylamino)oxan-2-yl]oxy-4-hydroxy-4-(hydroxymethyl)-5-methyl-5-tritiooxolan-2-yl]oxy-2,5,6-trihydroxycyclohexyl]guanidine
ASXBYYWOLISCLQ-WZIKVEFLSA-N
[3H][C@@]1([C@@]([C@H]([C@H](O1)O[C@@H]2[C@H]([C@@H]([C@H]([C@@H]([C@H]2O)O)NC(=N)N)O)N=C(N)N)O[C@H]3[C@H]([C@@H]([C@H]([C@@H](O3)CO)O)O)NC)(CO)O)C