(2-Benzylacryloyl)glycine is a chemical compound used as a reference standard in the manufacture and quality control of the pharmaceutical intermediate alvimopan. It is characterized by an aromatic ring, an amide group, and a carboxylic acid group, giving it moderate polarity and a single aromatic ring structure.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 76932-18-8
4-Chloro-3-methylbenzoic acid
Pharmaceutical intermediate
Phenyl(1H-pyrrol-2-yl)methanone
Pharmaceutical intermediate for drug synthesis
Deuterium chloride
Deuterated reagent for synthesis
D-3-(2-naphthyl)alanine
pharmaceutical intermediate
2-(2-benzylprop-2-enoylamino)acetic acid
FSCZNKNUJVBMPY-UHFFFAOYSA-N
C=C(CC1=CC=CC=C1)C(=O)NCC(=O)O