(R)-(+)-Cathinone hydrochloride is a research reagent and the hydrochloride salt of the optically active (R)-enantiomer of cathinone, a naturally occurring alkaloid. It is primarily used in scientific research and analytical reference applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 76333-53-4
Methyl 2,2-dimethylpent-4-enoate
research compound
Antimony(V) chloride
Lewis acid catalyst and reagent
2-(Trimethylsilyl)ethoxymethyl chloride
Protecting reagent for hydroxyl groups
2-(mesitylamino)-9,10-dimethoxy-6,7-dihydro-4H-pyrimido[6,1-a]isoquinolin-4-one
research compound
2-amino-1-phenylpropan-1-one;hydrochloride
pharmaceutical reference standard
Cathinone hydrochloride
active pharmaceutical ingredient
(2R)-2-amino-1-phenylpropan-1-one;hydrochloride
HPZCAKYHISJOIK-OGFXRTJISA-N
C[C@H](C(=O)C1=CC=CC=C1)N.Cl