This compound is a phenolic compound featuring two methyl groups and a phenyl ring on a phenol core, giving it a moderately lipophilic and aromatic character. Its chemical structure includes two aromatic rings and one hydrogen-bond donor site, with a LogP of 3.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 76219-34-6
3,5-dimethyl-2-phenylphenol
GHQKKXMTRJXSQY-UHFFFAOYSA-N
CC1=CC(=C(C(=C1)O)C2=CC=CC=C2)C
—