This compound is a boronic ester derivative of methoxypyridine, commonly used as a research reagent. It features a pinacol boronate group attached to a pyridine ring, making it useful in organic synthesis and medicinal chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 758699-74-0
Diethyl 2,3-difluorofumarate
fluorinated building block for synthesis
Ethyl 2-fluoro-3-oxopentanoate
research compound
1-Ethyl-1-nitrosourea
experimental mutagen and ethylating agent
2-ethenyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Vinyl boronate synthetic reagent
4-methoxy-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
FVHUFNSLTSKBDN-UHFFFAOYSA-N
B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2)OC
—