Carbobenzoxyphenylalanyl-phenylalanyl-glycine is a research compound with a tripeptide structure containing aromatic rings and multiple amide bonds. Its high flexibility and polar functional groups make it suitable for peptide-related studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 75539-79-6
Methyl 1H-indazole-7-carboxylate
research compound
CHAPS
non-denaturing biological detergent
2-Chlorothieno[2,3-c]pyridine
Research compound
(2-(Dimethylamino)pyrimidin-5-yl)boronic acid
research compound
2-[[(2S)-3-phenyl-2-[[(2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]propanoyl]amino]acetic acid
ZSOSVHOISBSKID-BJKOFHAPSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)O)NC(=O)[C@@H](CC2=CC=CC=C2)NC(=O)OCC3=CC=CC=C3