Sudan I-d5 is a deuterated analytical reference standard, specifically a pentadeuterio-labeled derivative of Sudan I. It is primarily used as an internal standard in analytical chemistry for the quantification of Sudan I in various samples.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 752211-63-5
4-Ethynyl-N,N-dimethylaniline
research compound
Methyl L-phenylalaninate hydrochloride
Research reagent for peptide synthesis
Sodium 2-(4-(2-hydroxyethyl)piperazin-1-yl)ethanesulfonate
dipolar ionic buffer
H-alpha-Me-D-Phe(4-Br)-OH
research compound
C.I. Solvent Yellow 14
Dye for hydrocarbon solvents and oils
1-(2-METHOXY-D3-PHENYLAZO)-2-NAPHTHOL
Azo dye for coloration
Crocein Orange G
synthetic azo dye for coloring
E129
food color additive
1-[(2,3,4,5,6-pentadeuteriophenyl)diazenyl]naphthalen-2-ol
MRQIXHXHHPWVIL-RCQSQLKUSA-N
[2H]C1=C(C(=C(C(=C1[2H])[2H])N=NC2=C(C=CC3=CC=CC=C32)O)[2H])[2H]