Methyl L-leucinate hydrochloride is a chemical compound used as a pharmaceutical intermediate. It is the hydrochloride salt of the methyl ester of the amino acid L-leucine and is primarily employed in peptide synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 7517-19-3
(2R,4S)-ethyl 5-([1,1'-biphenyl]-4-yl)-4-aMino-2-Methylpentanoate
Pharmaceutical intermediate synthesis
(S)-tert-butyl 3-(3,4-Dihydroxyphenyl)-1-(dimethylamino)-1-oxopropan-2-ylcarbamate
peptide building block intermediate
4-chloro-2-fluorobenzeneacetonitrile
Pharmaceutical intermediate
5-Bromo-6-chloronicotinamide
pharmaceutical intermediate
methyl (2S)-2-amino-4-methylpentanoate;hydrochloride
DODCBMODXGJOKD-RGMNGODLSA-N
CC(C)C[C@@H](C(=O)OC)N.Cl