N-Nitro tetradehydroargatroban is a chemical compound that serves as an intermediate in the synthesis of pharmaceutical agents. It features a complex structure with multiple ring systems and functional groups, including an amide and carboxylic acid, commonly associated with small-molecule drug manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 74874-10-5
Ethyl (2R,4R)-1-[(2S)-5-[[imino(nitroamino)methyl]amino]-2-[[(3-methyl-8-quinolinyl)sulfonyl]amino]-1-oxopentyl]-4-methyl-2-piperidinecarboxylate
Pharmaceutical intermediate for argatroban analog
Benzoic acid, 4-(acetylamino)-3-bromo-2-(2-bromoethoxy)-5-chloro-, methyl ester
pharmaceutical intermediate
(S)-(+)-2-Methylpiperazine
pharmaceutical intermediate
(2R,4R)-4-methylpiperidine-2-carboxylic acid
Chiral building block for synthesis
Ethyl (2R,4R)-4-methyl-2-piperidinecarboxylate
Pharmaceutical intermediate
(2R,4R)-1-[(2S)-5-[[amino(nitramido)methylidene]amino]-2-[(3-methylquinolin-8-yl)sulfonylamino]pentanoyl]-4-methylpiperidine-2-carboxylic acid
XBDLKMBSCAVLDV-FHLIZLRMSA-N
C[C@@H]1CCN([C@H](C1)C(=O)O)C(=O)[C@H](CCCN=C(N)N[N+](=O)[O-])NS(=O)(=O)C2=CC=CC3=C2N=CC(=C3)C