6-chloro-5-nitropyridine-3-carboxylic acid is a chemical compound used primarily as a research reagent. It features a pyridine ring substituted with chloro, nitro, and carboxylic acid functional groups, contributing to its moderate lipophilicity and polar surface area.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 7477-10-3
7-Chloroisatin
Chemical research intermediate
ATP dimagnesium salt
nucleotide research reagent
Tributyl(vinyl)tin
Stille coupling reagent for vinyl group transfer
2-AMINO-5-BROMO-3-FLUOROPYRIDINE
research compound
6-chloro-5-nitropyridine-3-carboxylic acid
HCRHNMXCDNACMH-UHFFFAOYSA-N
C1=C(C=NC(=C1[N+](=O)[O-])Cl)C(=O)O