Quinoline-2-boronic acid is a boronic acid derivative of quinoline used primarily as a research reagent. Its structure features an aromatic heterocyclic ring system with a boronic acid functional group, making it a versatile building block in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 745784-12-7
Ethyl cyclopropylideneacetate
research compound
Diethylene Glycol Bis(p-toluenesulfonate)
research compound for crystallography
1-(2-azidoethoxy)-2-(2-methoxyethoxy)ethane
PEG linker with azide group
(S)-4-AMINO-3-(4-FLUOROPHENYL)BUTANOIC ACID
Research compound
quinolin-2-ylboronic acid
DWHCQRBWSBKHMI-UHFFFAOYSA-N
B(C1=NC2=CC=CC=C2C=C1)(O)O