l-Alanine-d7 is an isotopically labeled form of the amino acid L-alanine, where seven hydrogen atoms are replaced by deuterium. It is primarily used as a research reagent in studies requiring a stable isotope-labeled internal standard, such as for analytical chemistry or metabolic tracing experiments.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 74280-71-0
Urethane-d5 (ethyl-d5)
isotopically labeled research compound
Nitrobenzene-(1)(3)C
isotopically labeled research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
1,3,5-Tribromobenzene-d3
isotopically labeled research compound
Triptophenolide
research compound
2'-Deoxyadenosine 5'-(disodium dihydrogen triphosphate)
Nucleotide triphosphate research reagent
1,2-O-Isopropylidene-sn-glycerol-d5
deuterated research reagent
2-bromo-4-methoxybenzoic acid
research compound
deuterio (2S)-2,3,3,3-tetradeuterio-2-(dideuterioamino)propanoate
QNAYBMKLOCPYGJ-VQIVFXRSSA-N
[2H][C@@](C(=O)O[2H])(C([2H])([2H])[2H])N([2H])[2H]