l-Alanine-d7 is an isotopically labeled form of the amino acid L-alanine, where seven hydrogen atoms are replaced by deuterium. It is primarily used as a research reagent in studies requiring a stable isotope-labeled internal standard, such as for analytical chemistry or metabolic tracing experiments.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء L-alanine-d7؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Urethane-d5 (ethyl-d5)
isotopically labeled research compound
Nitrobenzene-(1)(3)C
isotopically labeled research compound
2,4,6-Trichlorophen-3,5-d2-ol
isotopically labeled research compound
1,3,5-Tribromobenzene-d3
isotopically labeled research compound
Triptophenolide
research compound
2'-Deoxyadenosine 5'-(disodium dihydrogen triphosphate)
Nucleotide triphosphate research reagent
1,2-O-Isopropylidene-sn-glycerol-d5
deuterated research reagent
2-bromo-4-methoxybenzoic acid
research compound
deuterio (2S)-2,3,3,3-tetradeuterio-2-(dideuterioamino)propanoate
QNAYBMKLOCPYGJ-VQIVFXRSSA-N
[2H][C@@](C(=O)O[2H])(C([2H])([2H])[2H])N([2H])[2H]
هل تبحث عن شراء L-alanine-d7؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.