Di(succinimido) carbonate is a research reagent used as a coupling agent in peptide synthesis. Its structure consists of two succinimidyl groups linked by a carbonate moiety, which facilitates the formation of amide bonds under mild conditions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 74124-79-1
(Dimethylamino)((2,5-dioxopyrrolidin-1-yl)oxy)-N,N-dimethylmethaniminium hexafluorophosphate
coupling reagent for peptide synthesis
فيليبس سي دي-آي
coupling reagent for peptide synthesis
AMP-PCP (disodium)
research compound
ADA sodium salt
biological buffer reagent
Guanosine-5'-diphosphate disodium salt
nucleoside diphosphate research reagent
2-[(1S,6S)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]-5-pentylbenzene-1,3-diol
Certified reference standard
bis(2,5-dioxopyrrolidin-1-yl) carbonate
PFYXSUNOLOJMDX-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)ON2C(=O)CCC2=O