1,3-Di-p-tolylcarbodiimide is a carbodiimide compound featuring two 4-methylphenyl groups attached to the nitrogen atoms. It is used as a reagent in chemical synthesis, particularly as a carbodiimide coupling reagent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 726-42-1
Bis(morpholino)phosphinyl chloride
Chemical reagent for phosphorylation
Adenosine 5'-diphosphate monopotassium salt dihydrate
Nucleoside diphosphate research reagent
PT-ttpy
platinum-based research reagent
Methyl 1-aminocyclopropane-1-carboxylate hydrochloride
research compound
N,N'-bis(4-methylphenyl)methanediimine
BOSWPVRACYJBSJ-UHFFFAOYSA-N
CC1=CC=C(C=C1)N=C=NC2=CC=C(C=C2)C