Chloramphenicol base is a chemical compound used as a pharmaceutical intermediate in the manufacturing of the antibiotic chloramphenicol. It contains both alcohol and amine functional groups and is characterized by an aromatic ring and polar substituents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 716-61-0
Di-p-toluoyl-D-tartaric acid monohydrate
chiral resolution reagent
(2R,3R)-2,3-Bis((4-methylbenzoyl)oxy)succinic acid hydrate
chiral resolving agent intermediate
4-Amino-5-(ethylthio)-2-methoxybenzoic acid
Pharmaceutical intermediate for amisulpride impurities
4-amino-2-methoxy-5-(methylthio)benzoic acid
Pharmaceutical intermediate for amisulpride impurities
(1R,2R)-2-amino-1-(4-nitrophenyl)propane-1,3-diol
OCYJXSUPZMNXEN-RKDXNWHRSA-N
C1=CC(=CC=C1[C@H]([C@@H](CO)N)O)[N+](=O)[O-]