Succinylcholine chloride is a quaternary ammonium compound used as a muscle relaxant active pharmaceutical ingredient. It acts as a depolarizing neuromuscular blocker and is typically employed during surgical procedures to facilitate endotracheal intubation and provide skeletal muscle relaxation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 71-27-2
Dantrolene sodium hemiheptahydrate
muscle relaxant active pharmaceutical ingredient
أسيتات ميدروكسي بروجستيرون
hormonal progestin medication
Digitoxin
cardiac glycoside pharmaceutical ingredient
ثيوبنتال الصوديوم
intravenous anaesthetic
Isopropamide Iodide
anticholinergic active pharmaceutical ingredient
trimethyl-[2-[4-oxo-4-[2-(trimethylazaniumyl)ethoxy]butanoyl]oxyethyl]azanium dichloride
YOEWQQVKRJEPAE-UHFFFAOYSA-L
C[N+](C)(C)CCOC(=O)CCC(=O)OCC[N+](C)(C)C.[Cl-].[Cl-]