This compound is a chemical compound featuring an aromatic ring substituted with a trifluoromethyl group and a ketone group. It is commonly used as a building block or intermediate in chemical synthesis and research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 709-63-7
1-[4-(trifluoromethyl)phenyl]ethanone
HHAISVSEJFEWBZ-UHFFFAOYSA-N
CC(=O)C1=CC=C(C=C1)C(F)(F)F