This compound is a pharmaceutical intermediate, structurally related to diphenhydramine, an antihistamine and sedative. It contains aromatic rings and alcohol and amine functional groups, indicating its role in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 70708-28-0
Ethyl 2-((benzyloxy)amino)acetate
N-protected glycine derivative for peptide synthesis
4-benzylidene-2,6-di-tert-butylcyclohexa-2,5-dienone
pharmaceutical intermediate
(R)-2-(4-Hydroxy-6-methylnicotinamido)-2-(4-hydroxyphenyl)acetic acid
pharmaceutical intermediate
Cbz-D-2,4-Diaminobutyric acid
protected amino acid building block
(E)-3-(6-(1-Hydroxy-3-(pyrrolidin-1-yl)-1-(p-tolyl)propyl)pyridin-2-yl)acrylic acid
pharmaceutical active ingredient
1-(4-methylphenyl)-1-pyridin-2-yl-3-pyrrolidin-1-ylpropan-1-ol
LOJXVYLBLFSBBB-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(CCN2CCCC2)(C3=CC=CC=N3)O