This compound is a deuterium-labeled form of 4-aminobutanoic acid, specifically hexadeuterated at the carbon positions. It is primarily used as a stable isotope labeled analytical standard in research and laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 70607-85-1
Epsilon-Aminocaproic Acid-d10 Hydrochloride
research reagent for pharmacokinetic studies
3-((E)-((2-nitrophenyl)methylidene)amino)(2H4)-1,3-oxazolidin-2-one
stable isotope labeled analytical standard
Deschloroketamine
research compound
(S)-benzyl 2-((S)-2-amino-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
3,3-dimethylbutanoyl chloride
research compound
1,3,5-tribromoadamantane
reference standard for impurity analysis
حمض الغاما-أمينوبيوتيريك
active pharmaceutical ingredient
4-amino-2,2,3,3,4,4-hexadeuteriobutanoic acid
BTCSSZJGUNDROE-NMFSSPJFSA-N
[2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])N