D-Aspartic acid, dimethyl ester, hydrochloride is a chemical compound commonly supplied as a research reagent. It is the hydrochloride salt form of the dimethyl ester derivative of D-aspartic acid and is used primarily in laboratory settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 69630-50-8
Methyl 3-amino-6-bromopyrazine-2-carboxylate
chemical synthesis intermediate
4-(4-Fluorophenyl)-1-methyl-1,2,3,6-tetrahydropyridine
Research compound for pharmacological studies
6-Chloro-1,3-dimethyluracil
Research compound for biochemical studies
1-Methyl-2-pyrrolecarboxylic acid
research compound
H-Asp(ome)-OMe HCl
amino acid ester research compound
dimethyl (2R)-2-aminobutanedioate;hydrochloride
PNLXWGDXZOYUKB-PGMHMLKASA-N
COC(=O)C[C@H](C(=O)OC)N.Cl