Tris(3,5-dimethylphenyl)phosphine is an organophosphorus compound featuring a phosphorus atom bonded to three 3,5-dimethylphenyl groups. It is structurally characterized by three aromatic rings and is of interest in coordination chemistry and materials research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 69227-47-0
tris(3,5-dimethylphenyl)phosphane
XRALRSQLQXKXKP-UHFFFAOYSA-N
CC1=CC(=CC(=C1)P(C2=CC(=CC(=C2)C)C)C3=CC(=CC(=C3)C)C)C