This compound is a beta-amino acid derivative featuring a 4-methylphenyl substituent. It serves as a pharmaceutical intermediate primarily utilized in the synthesis of peptide-based compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 68208-18-4
Thiocyanic acid, 2-amino-5-nitrophenyl ester
Pharmaceutical intermediate synthesis
(1S,2S)-2-aminocyclopentan-1-ol hydrochloride
pharmaceutical intermediate
(1R,2R)-2-aminocyclopentan-1-ol hydrochloride
Pharmaceutical intermediate
4-ethylcyclohexanecarboxylic acid
pharmaceutical intermediate
3-amino-3-(4-methylphenyl)propanoic acid
XPDAKEOBPKFUAH-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(CC(=O)O)N