Heptafluoroisopropyl iodide is a perfluorinated organic compound featuring an iodine atom bonded to a carbon center. It is primarily used as a specialized building block in the synthesis of agrochemical and pharmaceutical intermediates.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 677-69-0
1,1,1,2,3,3,3-heptafluoro-2-iodopropane
BBZVTTKMXRPMHZ-UHFFFAOYSA-N
C(C(F)(F)F)(C(F)(F)F)(F)I