This compound is a chemical compound featuring a benzoic acid core with dichloro substitution and a tert-butoxycarbonyl (Boc) protected amino group. It serves as a pharmaceutical intermediate, primarily used in the synthesis of more complex active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 669713-58-0
Anthranilic acid, n-boc-3-methyl
Pharmaceutical intermediate for synthesis
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
3-(1-(tert-butoxycarbonyl)piperidin-2-yl)propanoic acid
Pharmaceutical intermediate for API synthesis
((2R,3S,5R)-5-(6-Amino-9H-purin-9-yl)-3-hydroxytetrahydrofuran-2-yl)methyl 4-methylbenzenesulfonate
pharmaceutical intermediate for nucleoside analogs
3,5-dichloro-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid
BGXDBARGFUXUJF-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC1=C(C=C(C=C1Cl)Cl)C(=O)O
—