Ethyl Pyruvate-3,3,3-d3 is a deuterated research compound labeled with three deuterium atoms at the methyl group. It is primarily used as a stable isotope internal standard in analytical chemistry and metabolic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 66966-38-9
2-PYRROLIDINONE-3,3,4,4,5,5-D6
Deuterated research compound
2-BROMOPYRIDINE-D4
Deuterated research compound
4-Bromobenzoic-d4 Acid
Deuterated research compound
2-Hydroxy Estrone-d4
Deuterated research compound
(9H-Fluoren-9-yl)methyl 2-(aminomethyl)piperidine-1-carboxylate--hydrogen chloride (1/1)
research compound
3-Aminomethyl-1-N-Fmoc-piperidine hydrochloride
Research reagent for peptide synthesis
4-(1-(tert-butoxycarbonyl)-1H-pyrrol-2-yl)benzoic acid
research compound
4,6-dibromodibenzothiophene
research compound for binuclear platinum complexes
ethyl 3,3,3-trideuterio-2-oxopropanoate
XXRCUYVCPSWGCC-BMSJAHLVSA-N
[2H]C([2H])([2H])C(=O)C(=O)OCC