Melatonin D4 is a deuterated form of the naturally occurring hormone melatonin, used as an internal standard in analytical chemistry and research. Its isotopically labeled structure enables precise quantification in mass spectrometry-based studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 66521-38-8
(+/-)-Mandelic-2,3,4,5,6-d5 Acid
deuterated research reference standard
Decanoic-d19 acid
deuterated research reference standard
Rabeprazole D4
deuterated research reference standard
4-chlorophenol-d4
deuterated research reference standard
2-BROMO-4,5-DIMETHYLPYRIDINE
research compound
CL 218,872
Benzodiazepine receptor research tool
6-Methoxynicotinic acid
Research compound
Acetone d6
NMR solvent and polar aprotic solvent
N-[1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide
DRLFMBDRBRZALE-NZLXMSDQSA-N
[2H]C([2H])(C1=CNC2=C1C=C(C=C2)OC)C([2H])([2H])NC(=O)C