Sodium 2-amino-4-chloro-5-methylbenzenesulfonate is a sulfonated aromatic amine compound used as an intermediate in dye manufacturing. It features an amine group, a chlorine substituent, and a sulfonate salt group, making it suitable for further chemical transformations in pigment and dye synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6627-59-4
2-methoxy-5-nitroaniline hydrochloride
dye intermediate
Solvent Blue 122
solvent dye
Hexasodium 4-amino-3,6-bis[[4-[[4-chloro-6-[(3-sulphonatophenyl)amino]-1,3,5-triazin-2-yl]amino]-2-sulphonatophenyl]azo]-5-hydroxynaphthalene-2,7-disulphonate
Reactive dye for textiles
N-(2,3-Dihydro-2-oxo-1H-benzimidazol-5-yl)-3-oxo-2-[[2-(trifluoromethyl)phenyl]azo]butyramide
Pigment for plastics
sodium 2-amino-4-chloro-5-methylbenzenesulfonate
KMIGBVSYNVXBEI-UHFFFAOYSA-M
CC1=CC(=C(C=C1Cl)N)S(=O)(=O)[O-].[Na+]