3-Bromopyridine-d4 is a deuterated analog of 3-bromopyridine, in which all four hydrogen atoms on the pyridine ring are replaced by deuterium. It is primarily used as a deuterated reference compound in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry for analytical and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 66148-14-9
(E)-3-(4-Amino-3,5-dimethylphenyl)acrylonitrile Hydrochloride
Research intermediate for pharmaceutical synthesis
4-(Bromomethyl)benzenesulfonyl chloride
Research reagent for sulfonyl chloride chemistry
Deuterotrifluoromethanesulfonic acid
deuterated triflic acid reference standard
5-Chloro-4-methoxypyridin-2-amine
research compound
3-BROMOPYRIDINE
building block in organic synthesis
3-bromo-2,4,5,6-tetradeuteriopyridine
NYPYPOZNGOXYSU-RHQRLBAQSA-N
[2H]C1=C(C(=C(N=C1[2H])[2H])Br)[2H]