5-Methoxy-1H-indole-3-ethylamine hydrochloride is a research compound supplied in salt form. It is structurally related to certain indole derivatives and is categorized as a Schedule I controlled substance under the US Controlled Substances Act, indicating high potential for abuse and no accepted medical use in the United States.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 66-83-1
5-METHOXYTRYPTAMINE
serotonergic receptor agonist tool compound
5-Aminovaleric acid
research compound and metabolite standard
L-norvaline
hypoglycemic and neuroprotective research compound
Triphenylsulfonium triflate
Photoacid generator for photoresists
Somatotropin (176-191)
research reagent
2-(5-methoxy-1H-indol-3-yl)ethanamine;hydrochloride
TXVAYRSEKRMEIF-UHFFFAOYSA-N
COC1=CC2=C(C=C1)NC=C2CCN.Cl