4-Amino-2-(trifluoromethyl)benzonitrile is a research compound featuring an aromatic ring substituted with an amino group, a nitrile group, and a trifluoromethyl group. It is primarily used as a laboratory reagent in chemical synthesis and research applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 654-70-6
4-Amino-5-chloro-2-methoxy-N-(piperidin-4-ylmethyl)benzamide hydrochloride
research compound
Cyclopropylacetonitrile
research compound
2-oxo-2,3-dihydro-1,3-benzoxazole-5-carboxylic acid
research compound
2,4-Diaminobutyric acid dihydrochloride, (+-)-
Research reagent for biochemical studies
4-amino-2-(trifluoromethyl)benzonitrile
PMDYLCUKSLBUHO-UHFFFAOYSA-N
C1=CC(=C(C=C1N)C(F)(F)F)C#N