Triclopyr-butotyl is a derivative of triclopyr, an organic compound in the pyridine class of herbicides. It functions as a systemic foliar herbicide that mimics the action of the plant growth hormone auxin, used primarily for controlling broad-leaved weeds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 64700-56-7
2-butoxyethyl 2-[(3,5,6-trichloro-2-pyridinyl)oxy]acetate
IVDRCZNHVGQBHZ-UHFFFAOYSA-N
CCCCOCCOC(=O)COC1=NC(=C(C=C1Cl)Cl)Cl