2-Amino-1H-1,3-benzodiazole-5-carbonitrile is a research compound featuring a benzimidazole core with an amino group and a nitrile substituent. It is primarily used as a laboratory reagent in chemical and biological research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 63655-40-3
Benzyl N6-benzyloxycarbonyl-L-lysinate hydrochloride
research compound
N,N,N',N'-Tetramethyl-p-phenylenediamine dihydrochloride
Electron donor reagent for research
4,4'-Bis(dimethylamino)diphenylamine
Cytotoxicity assay reagent
Ethyl azidoacetate
research intermediate organic synthesis
2-amino-3H-benzimidazole-5-carbonitrile
PNMKRBOIMTZVLQ-UHFFFAOYSA-N
C1=CC2=C(C=C1C#N)NC(=N2)N