2-Hydroxy-3-nitropyridine is a chemical compound featuring a pyridine ring with a hydroxyl group and a nitro substituent. It has moderate polarity and limited hydrogen-bond donating capacity, making it suitable for use in research and chemical synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6332-56-5
3-nitro-1H-pyridin-2-one
BOAFCICMVMFLIT-UHFFFAOYSA-N
C1=CNC(=O)C(=C1)[N+](=O)[O-]