2,6-bis(pyrazol-3-yl)pyridine is a research reagent commonly employed as a ligand in coordination chemistry, where it binds to metal centers to form stable complexes. Its significance lies in its tridentate geometry, featuring two pyrazole rings attached to a central pyridine unit, which enables diverse coordination modes in organometallic and materials research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء 2,6-bis(pyrazol-3-yl)pyridine؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
2-Pyridyldiphenylphosphine
ligand for coordination chemistry
Tris(2-methoxyphenyl)phosphine
ligand for coordination chemistry
2-(2,4-dimethylphenyl)acetic acid
Research compound
2,4-diphenylaniline
Research chemical intermediate
Ethanol, 2-[2-(2-aminoethoxy)ethoxy]-
polyethylene glycol amine linker
PYRROLE-2-CARBOXYLIC ACID
organic synthesis research compound
2,6-bis(1H-pyrazol-5-yl)pyridine
WEHSLQMKHNECMN-UHFFFAOYSA-N
C1=CC(=NC(=C1)C2=CC=NN2)C3=CC=NN3
هل تبحث عن شراء 2,6-bis(pyrazol-3-yl)pyridine؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.