Tetraphenylmethane is an organic compound consisting of a central carbon atom bonded to four phenyl groups. It is primarily utilized as a chemical building block in organic synthesis and materials research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 630-76-2
2-(2,5-dioxo-2,5-dihydro-1H-pyrrol-1-yl)acetic acid
chemical building block
حمض الهيبوفوسفوروز
Reducing agent and electroplating baths
1,2-Bis(tosyloxy)ethane
chemical reagent for organic synthesis
Methylene dithiocyanate
Biocide and wood preservative
Tetrabromophthalic anhydride
reactive flame retardant
4-Tritylaniline
Pharmaceutical intermediate for synthesis
tritylbenzene
PEQHIRFAKIASBK-UHFFFAOYSA-N
C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4