This compound is an active pharmaceutical ingredient characterized as a derivative of piperazine and hydroxyphenylacetic acid. It features a complex molecular structure with multiple amide groups and an aromatic ring, reflecting its role in pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 62893-24-7
(R)-2-(4-Ethyl-2,3-dioxopiperazine-1-carboxamido)-2-phenylacetic acid
intermediate for cephalosporin and beta-lactam antibiotics
Aspirin DL-lysine
active pharmaceutical ingredient
Primaquine diphosphate
antimalarial active pharmaceutical ingredient
Sulfanilamide
sulfonamide antibacterial drug
Colfosceril palmitate
pulmonary surfactant drug
(2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-(4-hydroxyphenyl)acetic acid
IPARGUVYMOMVNU-LLVKDONJSA-N
CCN1CCN(C(=O)C1=O)C(=O)N[C@H](C2=CC=C(C=C2)O)C(=O)O