This compound is a peracetylated derivative of 1-thio-α-D-glucopyranose, commonly used as a synthetic carbohydrate reagent in organic chemistry. Its structure features a thioglucose framework with multiple acetate protecting groups, making it a valuable building block for glycosylation reactions and oligosaccharide synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 62860-10-0
2-Chloro-3-fluoropyridine-4-carboxylic acid
Research compound
2,5-Dimethoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
2-Hydroxyoctadecanoic acid
research compound
1-IODOOCTANE
Research reagent
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-acetylsulfanyloxan-2-yl]methyl acetate
CFAJEDWNNGFOQV-IBEHDNSVSA-N
CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)SC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
—