2,2,2-Trifluoroethyl trifluoromethanesulfonate is a fluorinated chemical compound used primarily as a pharmaceutical intermediate. Its significance lies in its role in the synthesis of drug compounds, particularly those requiring trifluoroethyl group incorporation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 6226-25-1
Propyltriphenylphosphonium bromide
pharmaceutical intermediate
Cyclopropanecarboxamide
pharmaceutical intermediate for prasugrel
((2E,4E)-3-Methyl-5-(2,6,6-trimethylcyclohex-2-en-1-yl)penta-2,4-dien-1-yl)triphenylphosphonium bromide
intermediate for acitretin synthesis
4-Aminobenzyl alcohol
pharmaceutical intermediate
2,2,2-trifluoroethyl trifluoromethanesulfonate
RTMMSCJWQYWMNK-UHFFFAOYSA-N
C(C(F)(F)F)OS(=O)(=O)C(F)(F)F