(R)-1-Cbz-2-cyanopyrrolidine is a chiral pyrrolidine derivative with a benzyl carbamate protecting group and a nitrile substituent. It serves as a pharmaceutical intermediate used in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 620601-77-6
Benzyl 2-cyanopiperidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
Tert-butyl 4-aminomethyl-4-fluoropiperidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
L-Alanine isopropyl ester hydrochloride
Pharmaceutical intermediate for sofosbuvir synthesis
Trans-4-Aminoadamantan-1-ol Hydrochloride
Pharmaceutical intermediate
3-Hydroxyacetanilide
pharmaceutical intermediate, research compound
(S)-1-N-Cbz-2-cyano-pyrrolidine
pharmaceutical intermediate
benzyl (2R)-2-cyanopyrrolidine-1-carboxylate
AUVGQGIWVNDVSL-GFCCVEGCSA-N
C1C[C@@H](N(C1)C(=O)OCC2=CC=CC=C2)C#N