4-Nitrobenzoic acid is a pale yellow organic solid used as an intermediate in the production of pharmaceuticals and dyes. It serves as a precursor to 4-nitrobenzoyl chloride, which is further utilized in the synthesis of compounds such as the anesthetic procaine and folic acid.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 62-23-7
4-CHLOROBENZOTRICHLORIDE
Intermediate for pharmaceuticals and dyes
3-Chlorobenzyl chloride
synthetic intermediate for pharmaceuticals
N-Cbz-(2R,3R)-3-amino-2-hydroxy-4-phenylbutyric acid
pharmaceutical intermediate
(2S,3S)-3-(Z-amino)-2-hydroxy-4-phenylbutyric acid
protected amino acid intermediate
(2R,3R)-3-amino-2-hydroxy-4-phenylbutanoic acid
Impurity standard for ubenimex
4-Nitrobenzoic Acid-d4
isotope labeled research compound
4-nitrobenzoic acid
OTLNPYWUJOZPPA-UHFFFAOYSA-N
C1=CC(=CC=C1C(=O)O)[N+](=O)[O-]