2-Bromo-N-phenylaniline is a chemical compound commonly used as a research reagent. It features an amine functional group, two aromatic rings, and a bromine substituent, contributing to its utility in laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 61613-22-7
Tri-o-tolylphosphine
phosphine ligand for catalysis
2-Thiopheneboronic acid
Boronic acid building block for synthesis
Thiophene-3-boronic acid
Boronic acid reagent for synthesis
2-Isopropoxy-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Boron reagent for organic synthesis
2-bromo-N-phenylaniline
WAAWAHYRHUWAFM-UHFFFAOYSA-N
C1=CC=C(C=C1)NC2=CC=CC=C2Br