4-Nitrobenzyl acetoacetate is an organic compound featuring a nitro-substituted aromatic ring and a β-keto ester group. It is commonly used as a research reagent in organic synthesis and laboratory investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 61312-84-3
Mono-4-nitrobenzyl Malonate
Pharmaceutical intermediate
Bis(p-nitrobenzyl hydrogen malonato)magnesium
Pharmaceutical intermediate for synthesis
2-chloro-3-nitro-1,8-naphthyridine
research compound for chemical synthesis
4-BROMOANILINE-2,3,5,6-D4
deuterated research compound
3-Acetylbenzonitrile
research compound
4-(Aminosulphonyl)benzeneboronic acid
Research reagent for chemical synthesis
(4-nitrophenyl)methyl 3-oxobutanoate
KQPGVCMZXFBYMM-UHFFFAOYSA-N
CC(=O)CC(=O)OCC1=CC=C(C=C1)[N+](=O)[O-]