2-Benzylbenzoic acid is a naturally occurring compound found in certain Populus species, including Populus tomentosa and Populus tremuloides. It is an aromatic carboxylic acid with two benzene rings connected by a methylene bridge.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 612-35-1
2-benzylbenzoic acid
FESDHLLVLYZNFY-UHFFFAOYSA-N
C1=CC=C(C=C1)CC2=CC=CC=C2C(=O)O