4-Amino-3-nitrophenol is an aromatic compound featuring both an amino and a nitro substituent on a phenol ring. It is commonly employed as a pharmaceutical intermediate in the synthesis of various active ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 610-81-1
Methyl 2-iodobenzoate
Pharmaceutical intermediate for synthesis
N-Desmethylclozapine
major metabolite of clozapine
4-Chloro-2-fluorobenzaldehyde
pharmaceutical intermediate
Josamycin Propionate EP Impurity A
Pharmaceutical impurity reference standard
4-amino-3-nitrophenol
IQXUIDYRTHQTET-UHFFFAOYSA-N
C1=CC(=C(C=C1O)[N+](=O)[O-])N