2-Amino-3-nitrobenzoic acid is a crystalline research compound characterized by an aromatic ring with both amino and nitro substituents adjacent to a carboxylic acid group. It is primarily of interest in structural chemistry and crystallographic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 606-18-8
1,3-Indanedione
chemical intermediate for organic synthesis
Dihydronicotinamide-adenine dinucleotide, disodium salt
biochemical research reagent
13-Azido-2,5,8,11-tetraoxatridecane
PEG-based azide reagent
Dimethylpropanedioic acid dimethyl ester
research compound
2-amino-3-nitrobenzoic acid
JJPIVRWTAGQTPQ-UHFFFAOYSA-N
C1=CC(=C(C(=C1)[N+](=O)[O-])N)C(=O)O