1,1-Diphenylethanol is a chemical compound composed of two phenyl rings attached to a central carbon bearing a hydroxyl group and a methyl group. It is characterized by its alcohol functional group and aromatic ring system, commonly used in organic synthesis and as a laboratory reagent.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 599-67-7
1,1-diphenylethanol
GIMDPFBLSKQRNP-UHFFFAOYSA-N
CC(C1=CC=CC=C1)(C2=CC=CC=C2)O