2-Bromo-1-phenylhexan-1-one is a chemical compound used as a research reagent. It features a bromine atom and a phenyl ring, contributing to its utility in laboratory synthesis and investigation.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 59774-06-0
2-bromo-1-phenyl-pentan-1-one
pharmaceutical intermediate
5-cyanothiophene-2-carboxylic acid
research compound
2,4,6-Trimethylbenzeneboronic acid
Research reagent for organic synthesis
(1,3-Bis(diphenylphosphino)propane)palladium(II) chloride
catalyst for cross-coupling reactions
8-Azaxanthine monohydrate
Research reagent for biochemical studies
2-bromo-1-phenylhexan-1-one
MQIJCWVCTPNMKW-UHFFFAOYSA-N
CCCCC(C(=O)C1=CC=CC=C1)Br